C10H11BrN2S2 — CID 104599797
N-[(4-bromothiophen-2-yl)methyl]-5-ethyl-1,3-thiazol-2-amine (PubChem CID 104599797) has the molecular formula C10H11BrN2S2 and a molecular weight of 303.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-5-ethyl-1,3-thiazol-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-5-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104599797 |
| Molecular Formula | C10H11BrN2S2 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-5-ethyl-1,3-thiazol-2-amine |
| SMILES | CCc1cnc(NCc2cc(Br)cs2)s1 |
| InChI | InChI=1S/C10H11BrN2S2/c1-2-8-4-12-10(15-8)13-5-9-3-7(11)6-14-9/h3-4,6H,2,5H2,1H3,(H,12,13) |
| InChIKey | JZSNUSANXSHJCJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |