C15H24N4S2 — CID 80595351
5,6-diethyl-3-(thian-2-ylmethylamino)pyridazine-4-carbothioamide (PubChem CID 80595351) has the molecular formula C15H24N4S2 and a molecular weight of 324.52 g/mol. Its IUPAC name is 5,6-diethyl-3-(thian-2-ylmethylamino)pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-(thian-2-ylmethylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80595351 |
| Molecular Formula | C15H24N4S2 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 5,6-diethyl-3-(thian-2-ylmethylamino)pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(NCC2CCCCS2)c(C(N)=S)c1CC |
| InChI | InChI=1S/C15H24N4S2/c1-3-11-12(4-2)18-19-15(13(11)14(16)20)17-9-10-7-5-6-8-21-10/h10H,3-9H2,1-2H3,(H2,16,20)(H,17,19) |
| InChIKey | XTSPXFDXXPTSNN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|