C11H18N4S2 — CID 80585623
1,3-dimethyl-5-(thiolan-2-ylmethylamino)pyrazole-4-carbothioamide (PubChem CID 80585623) has the molecular formula C11H18N4S2 and a molecular weight of 270.43 g/mol. Its IUPAC name is 1,3-dimethyl-5-(thiolan-2-ylmethylamino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(thiolan-2-ylmethylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 80585623 |
| Molecular Formula | C11H18N4S2 |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1,3-dimethyl-5-(thiolan-2-ylmethylamino)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCC2CCCS2)c1C(N)=S |
| InChI | InChI=1S/C11H18N4S2/c1-7-9(10(12)16)11(15(2)14-7)13-6-8-4-3-5-17-8/h8,13H,3-6H2,1-2H3,(H2,12,16) |
| InChIKey | OGIMFLNMFJLTPG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|