C13H22N4S — CID 63756865
1,3-dimethyl-5-[(3-methylcyclohexyl)amino]pyrazole-4-carbothioamide (PubChem CID 63756865) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(3-methylcyclohexyl)amino]pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-[(3-methylcyclohexyl)amino]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63756865 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1,3-dimethyl-5-[(3-methylcyclohexyl)amino]pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NC2CCCC(C)C2)c1C(N)=S |
| InChI | InChI=1S/C13H22N4S/c1-8-5-4-6-10(7-8)15-13-11(12(14)18)9(2)16-17(13)3/h8,10,15H,4-7H2,1-3H3,(H2,14,18) |
| InChIKey | WFZPDJSGKYMHAD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|