C10H16N4OS — CID 80713370
1,3-dimethyl-5-(oxolan-3-ylamino)pyrazole-4-carbothioamide (PubChem CID 80713370) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 1,3-dimethyl-5-(oxolan-3-ylamino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(oxolan-3-ylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 80713370 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1,3-dimethyl-5-(oxolan-3-ylamino)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NC2CCOC2)c1C(N)=S |
| InChI | InChI=1S/C10H16N4OS/c1-6-8(9(11)16)10(14(2)13-6)12-7-3-4-15-5-7/h7,12H,3-5H2,1-2H3,(H2,11,16) |
| InChIKey | KJIVRMGXMPPSBU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|