C11H18N4O2S2 — CID 63758439
5-[(1,1-dioxothiolan-3-yl)methylamino]-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63758439) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)methylamino]-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)methylamino]-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758439 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)methylamino]-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCC2CCS(=O)(=O)C2)c1C(N)=S |
| InChI | InChI=1S/C11H18N4O2S2/c1-7-9(10(12)18)11(15(2)14-7)13-5-8-3-4-19(16,17)6-8/h8,13H,3-6H2,1-2H3,(H2,12,18) |
| InChIKey | ZMVOBFHOKDKCFP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|