C10H18N4OS2 — CID 113484138
1,3-dimethyl-5-(2-methylsulfinylpropylamino)pyrazole-4-carbothioamide (PubChem CID 113484138) has the molecular formula C10H18N4OS2 and a molecular weight of 274.42 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2-methylsulfinylpropylamino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(2-methylsulfinylpropylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 113484138 |
| Molecular Formula | C10H18N4OS2 |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1,3-dimethyl-5-(2-methylsulfinylpropylamino)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCC(C)S(C)=O)c1C(N)=S |
| InChI | InChI=1S/C10H18N4OS2/c1-6(17(4)15)5-12-10-8(9(11)16)7(2)13-14(10)3/h6,12H,5H2,1-4H3,(H2,11,16) |
| InChIKey | ZISCUVWKDJEVEQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|