C13H25N5S — CID 63757710
5-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63757710) has the molecular formula C13H25N5S and a molecular weight of 283.44 g/mol. Its IUPAC name is 5-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63757710 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 5-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCC(C)(C)CN(C)C)c1C(N)=S |
| InChI | InChI=1S/C13H25N5S/c1-9-10(11(14)19)12(18(6)16-9)15-7-13(2,3)8-17(4)5/h15H,7-8H2,1-6H3,(H2,14,19) |
| InChIKey | WFFARXNLUOENDL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|