About ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate
ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate (PubChem CID 64575628) has the molecular formula C12H20N4O2S
and a molecular weight of 284.38 g/mol. Its IUPAC name is ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate |
| PubChem CID | 64575628 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNc1c(C(N)=S)c(C)nn1C |
| InChI | InChI=1S/C12H20N4O2S/c1-4-18-9(17)6-5-7-14-12-10(11(13)19)8(2)15-16(12)3/h14H,4-7H2,1-3H3,(H2,13,19) |
| InChIKey | LJWZKMSNSIDOJP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate?
The IUPAC name of ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate (CID 64575628) is ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate.
What is the SMILES notation for ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate?
The canonical SMILES for ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate is CCOC(=O)CCCNc1c(C(N)=S)c(C)nn1C.
What is the InChIKey of ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate?
The InChIKey is LJWZKMSNSIDOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2S/c1-4-18-9(17)6-5-7-14-12-10(11(13)19)8(2)15-16(12)3/h14H,4-7H2,1-3H3,(H2,13,19).
What are the key properties of ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate?
ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate has a molecular weight of 284.38 g/mol, XLogP of 1.12, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]butanoate is sourced from PubChem (CID 64575628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).