C15H20N4OS — CID 63758606
1,3-dimethyl-5-(3-phenoxypropylamino)pyrazole-4-carbothioamide (PubChem CID 63758606) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-phenoxypropylamino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(3-phenoxypropylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758606 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1,3-dimethyl-5-(3-phenoxypropylamino)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCCCOc2ccccc2)c1C(N)=S |
| InChI | InChI=1S/C15H20N4OS/c1-11-13(14(16)21)15(19(2)18-11)17-9-6-10-20-12-7-4-3-5-8-12/h3-5,7-8,17H,6,9-10H2,1-2H3,(H2,16,21) |
| InChIKey | PUECZVZRQCHGKF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|