C9H16N4O2S2 — CID 55241529
1,3-dimethyl-5-(2-methylsulfonylethylamino)pyrazole-4-carbothioamide (PubChem CID 55241529) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2-methylsulfonylethylamino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(2-methylsulfonylethylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 55241529 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1,3-dimethyl-5-(2-methylsulfonylethylamino)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCCS(C)(=O)=O)c1C(N)=S |
| InChI | InChI=1S/C9H16N4O2S2/c1-6-7(8(10)16)9(13(2)12-6)11-4-5-17(3,14)15/h11H,4-5H2,1-3H3,(H2,10,16) |
| InChIKey | BLFDCBVMWGRFGB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|