C10H16N4O2S — CID 63756872
methyl 3-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]propanoate (PubChem CID 63756872) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is methyl 3-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]propanoate.
| Compound Name | methyl 3-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]propanoate |
|---|---|
| PubChem CID | 63756872 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | methyl 3-[(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1c(C(N)=S)c(C)nn1C |
| InChI | InChI=1S/C10H16N4O2S/c1-6-8(9(11)17)10(14(2)13-6)12-5-4-7(15)16-3/h12H,4-5H2,1-3H3,(H2,11,17) |
| InChIKey | SIZVQFZLWQXBAU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|