C11H21N5S — CID 63756859
5-[3-(dimethylamino)propylamino]-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63756859) has the molecular formula C11H21N5S and a molecular weight of 255.39 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylamino]-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-[3-(dimethylamino)propylamino]-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63756859 |
| Molecular Formula | C11H21N5S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 5-[3-(dimethylamino)propylamino]-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCCCN(C)C)c1C(N)=S |
| InChI | InChI=1S/C11H21N5S/c1-8-9(10(12)17)11(16(4)14-8)13-6-5-7-15(2)3/h13H,5-7H2,1-4H3,(H2,12,17) |
| InChIKey | JXUMKVLRLDCPIN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|