C12H21N5 — CID 63758377
5-[4-(dimethylamino)butylamino]-1,3-dimethylpyrazole-4-carbonitrile (PubChem CID 63758377) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-[4-(dimethylamino)butylamino]-1,3-dimethylpyrazole-4-carbonitrile.
| Compound Name | 5-[4-(dimethylamino)butylamino]-1,3-dimethylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 63758377 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-[4-(dimethylamino)butylamino]-1,3-dimethylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(NCCCCN(C)C)c1C#N |
| InChI | InChI=1S/C12H21N5/c1-10-11(9-13)12(17(4)15-10)14-7-5-6-8-16(2)3/h14H,5-8H2,1-4H3 |
| InChIKey | GDRVXZGYBFNRDI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|