C10H16N4O — CID 63757669
5-(3-methoxypropylamino)-1,3-dimethylpyrazole-4-carbonitrile (PubChem CID 63757669) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-(3-methoxypropylamino)-1,3-dimethylpyrazole-4-carbonitrile.
| Compound Name | 5-(3-methoxypropylamino)-1,3-dimethylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 63757669 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-(3-methoxypropylamino)-1,3-dimethylpyrazole-4-carbonitrile |
| SMILES | COCCCNc1c(C#N)c(C)nn1C |
| InChI | InChI=1S/C10H16N4O/c1-8-9(7-11)10(14(2)13-8)12-5-4-6-15-3/h12H,4-6H2,1-3H3 |
| InChIKey | RRCFNOBZUOZSGM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|