C9H15N5 — CID 63758903
1,3-dimethyl-5-[2-(methylamino)ethylamino]pyrazole-4-carbonitrile (PubChem CID 63758903) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-[2-(methylamino)ethylamino]pyrazole-4-carbonitrile.
| Compound Name | 1,3-dimethyl-5-[2-(methylamino)ethylamino]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 63758903 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1,3-dimethyl-5-[2-(methylamino)ethylamino]pyrazole-4-carbonitrile |
| SMILES | CNCCNc1c(C#N)c(C)nn1C |
| InChI | InChI=1S/C9H15N5/c1-7-8(6-10)9(14(3)13-7)12-5-4-11-2/h11-12H,4-5H2,1-3H3 |
| InChIKey | SDOVIKAWCLPKJJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 65.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|