2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid

C8H10N4O2 — CID 63758168

IUPAC2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid
SMILESCc1nn(C)c(NCC(=O)O)c1C#N
InChIInChI=1S/C8H10N4O2/c1-5-6(3-9)8(12(2)11-5)10-4-7(13)14/h10H,4H2,1-2H3,(H,13,14)
InChIKeyTWDAMLRKSNZMEU-UHFFFAOYSA-N
MW194.19 g/mol
LogP0.10
Rot. Bonds3

About 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid

2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid (PubChem CID 63758168) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid
PubChem CID63758168
Molecular FormulaC8H10N4O2
Molecular Weight194.19 g/mol
Exact Mass194.08
IUPAC Name2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid
SMILESCc1nn(C)c(NCC(=O)O)c1C#N
InChIInChI=1S/C8H10N4O2/c1-5-6(3-9)8(12(2)11-5)10-4-7(13)14/h10H,4H2,1-2H3,(H,13,14)
InChIKeyTWDAMLRKSNZMEU-UHFFFAOYSA-N
XLogP0.10
TPSA90.94 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 50.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid?
The IUPAC name of 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid (CID 63758168) is 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid.
What is the SMILES notation for 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid?
The canonical SMILES for 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid is Cc1nn(C)c(NCC(=O)O)c1C#N.
What is the InChIKey of 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid?
The InChIKey is TWDAMLRKSNZMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-5-6(3-9)8(12(2)11-5)10-4-7(13)14/h10H,4H2,1-2H3,(H,13,14).
What are the key properties of 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid?
2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid has a molecular weight of 194.19 g/mol, XLogP of 0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-cyano-1,3-dimethylpyrazol-5-yl)amino]acetic acid is sourced from PubChem (CID 63758168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).