C15H17N3OS — CID 62380787
6-(3-phenoxypropylamino)pyridine-3-carbothioamide (PubChem CID 62380787) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 6-(3-phenoxypropylamino)pyridine-3-carbothioamide.
| Compound Name | 6-(3-phenoxypropylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 62380787 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 6-(3-phenoxypropylamino)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(NCCCOc2ccccc2)nc1 |
| InChI | InChI=1S/C15H17N3OS/c16-15(20)12-7-8-14(18-11-12)17-9-4-10-19-13-5-2-1-3-6-13/h1-3,5-8,11H,4,9-10H2,(H2,16,20)(H,17,18) |
| InChIKey | WFODEFMYVOZRFU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|