C13H17N5O — CID 80918884
6-hydrazinyl-N-(3-phenoxypropyl)pyrazin-2-amine (PubChem CID 80918884) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-hydrazinyl-N-(3-phenoxypropyl)pyrazin-2-amine.
| Compound Name | 6-hydrazinyl-N-(3-phenoxypropyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 80918884 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 6-hydrazinyl-N-(3-phenoxypropyl)pyrazin-2-amine |
| SMILES | NNc1cncc(NCCCOc2ccccc2)n1 |
| InChI | InChI=1S/C13H17N5O/c14-18-13-10-15-9-12(17-13)16-7-4-8-19-11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8,14H2,(H2,16,17,18) |
| InChIKey | UVGNUYGPAWZAHC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|