C14H16FN3O — CID 133469091
N-[3-(4-fluorophenoxy)propyl]-6-methylpyrazin-2-amine (PubChem CID 133469091) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-6-methylpyrazin-2-amine.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-6-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 133469091 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-6-methylpyrazin-2-amine |
| SMILES | Cc1cncc(NCCCOc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H16FN3O/c1-11-9-16-10-14(18-11)17-7-2-8-19-13-5-3-12(15)4-6-13/h3-6,9-10H,2,7-8H2,1H3,(H,17,18) |
| InChIKey | WYTAJJNGKRQWJX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|