C17H17F2N5O — CID 133291797
N-[2-(3,4-difluorophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine (PubChem CID 133291797) has the molecular formula C17H17F2N5O and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 133291797 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine |
| SMILES | Cc1cc(C)n(-c2cncc(NCCOc3ccc(F)c(F)c3)n2)n1 |
| InChI | InChI=1S/C17H17F2N5O/c1-11-7-12(2)24(23-11)17-10-20-9-16(22-17)21-5-6-25-13-3-4-14(18)15(19)8-13/h3-4,7-10H,5-6H2,1-2H3,(H,21,22) |
| InChIKey | NWIIKLIDMKHKNF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|