C17H18BrN5O — CID 133284460
N-[2-(4-bromophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine (PubChem CID 133284460) has the molecular formula C17H18BrN5O and a molecular weight of 388.27 g/mol. Its IUPAC name is N-[2-(4-bromophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine.
| Compound Name | N-[2-(4-bromophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 133284460 |
| Molecular Formula | C17H18BrN5O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[2-(4-bromophenoxy)ethyl]-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine |
| SMILES | Cc1cc(C)n(-c2cncc(NCCOc3ccc(Br)cc3)n2)n1 |
| InChI | InChI=1S/C17H18BrN5O/c1-12-9-13(2)23(22-12)17-11-19-10-16(21-17)20-7-8-24-15-5-3-14(18)4-6-15/h3-6,9-11H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | CRATYJMTUMWXSV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|