C19H19F3N6O — CID 133273965
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 133273965) has the molecular formula C19H19F3N6O and a molecular weight of 404.40 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 133273965 |
| Molecular Formula | C19H19F3N6O |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C)n(-c2cncc(NCCNC(=O)c3ccc(C(F)(F)F)cc3)n2)n1 |
| InChI | InChI=1S/C19H19F3N6O/c1-12-9-13(2)28(27-12)17-11-23-10-16(26-17)24-7-8-25-18(29)14-3-5-15(6-4-14)19(20,21)22/h3-6,9-11H,7-8H2,1-2H3,(H,24,26)(H,25,29) |
| InChIKey | UGRUOKGSZZUBHB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|