C13H22N4O3 — CID 63757140
7-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]heptanoic acid (PubChem CID 63757140) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 7-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]heptanoic acid.
| Compound Name | 7-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]heptanoic acid |
|---|---|
| PubChem CID | 63757140 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 7-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]heptanoic acid |
| SMILES | Cc1nn(C)c(NCCCCCCC(=O)O)c1C(N)=O |
| InChI | InChI=1S/C13H22N4O3/c1-9-11(12(14)20)13(17(2)16-9)15-8-6-4-3-5-7-10(18)19/h15H,3-8H2,1-2H3,(H2,14,20)(H,18,19) |
| InChIKey | VSTVWOLXGNFMKE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|