C13H24N6O — CID 63758205
1,3-dimethyl-5-(3-piperazin-1-ylpropylamino)pyrazole-4-carboxamide (PubChem CID 63758205) has the molecular formula C13H24N6O and a molecular weight of 280.38 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-piperazin-1-ylpropylamino)pyrazole-4-carboxamide.
| Compound Name | 1,3-dimethyl-5-(3-piperazin-1-ylpropylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63758205 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1,3-dimethyl-5-(3-piperazin-1-ylpropylamino)pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(NCCCN2CCNCC2)c1C(N)=O |
| InChI | InChI=1S/C13H24N6O/c1-10-11(12(14)20)13(18(2)17-10)16-4-3-7-19-8-5-15-6-9-19/h15-16H,3-9H2,1-2H3,(H2,14,20) |
| InChIKey | RADBORPPDNLLII-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|