C17H33Cl2N5O — CID 119394606
2-methyl-N-(3-piperazin-1-ylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide;dihydrochloride (PubChem CID 119394606) has the molecular formula C17H33Cl2N5O and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-methyl-N-(3-piperazin-1-ylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide;dihydrochloride.
| Compound Name | 2-methyl-N-(3-piperazin-1-ylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119394606 |
| Molecular Formula | C17H33Cl2N5O |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-methyl-N-(3-piperazin-1-ylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide;dihydrochloride |
| SMILES | Cc1nn(C)c(C)c1CC(C)C(=O)NCCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H31N5O.2ClH/c1-13(12-16-14(2)20-21(4)15(16)3)17(23)19-6-5-9-22-10-7-18-8-11-22;;/h13,18H,5-12H2,1-4H3,(H,19,23);2*1H |
| InChIKey | JJDRVXWGZHVSCY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|