C13H28ClN3O — CID 119393199
2-ethyl-N-(3-piperazin-1-ylpropyl)butanamide;hydrochloride (PubChem CID 119393199) has the molecular formula C13H28ClN3O and a molecular weight of 277.84 g/mol. Its IUPAC name is 2-ethyl-N-(3-piperazin-1-ylpropyl)butanamide;hydrochloride.
| Compound Name | 2-ethyl-N-(3-piperazin-1-ylpropyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119393199 |
| Molecular Formula | C13H28ClN3O |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-ethyl-N-(3-piperazin-1-ylpropyl)butanamide;hydrochloride |
| SMILES | CCC(CC)C(=O)NCCCN1CCNCC1.Cl |
| InChI | InChI=1S/C13H27N3O.ClH/c1-3-12(4-2)13(17)15-6-5-9-16-10-7-14-8-11-16;/h12,14H,3-11H2,1-2H3,(H,15,17);1H |
| InChIKey | FCIJKBSUBNHWOX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|