C18H38Cl2N4O2 — CID 119393081
3-ethyl-2-morpholin-4-yl-N-(3-piperazin-1-ylpropyl)pentanamide;dihydrochloride (PubChem CID 119393081) has the molecular formula C18H38Cl2N4O2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-ethyl-2-morpholin-4-yl-N-(3-piperazin-1-ylpropyl)pentanamide;dihydrochloride.
| Compound Name | 3-ethyl-2-morpholin-4-yl-N-(3-piperazin-1-ylpropyl)pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119393081 |
| Molecular Formula | C18H38Cl2N4O2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 3-ethyl-2-morpholin-4-yl-N-(3-piperazin-1-ylpropyl)pentanamide;dihydrochloride |
| SMILES | CCC(CC)C(C(=O)NCCCN1CCNCC1)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C18H36N4O2.2ClH/c1-3-16(4-2)17(22-12-14-24-15-13-22)18(23)20-6-5-9-21-10-7-19-8-11-21;;/h16-17,19H,3-15H2,1-2H3,(H,20,23);2*1H |
| InChIKey | SOSBQKZEWUTMKN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|