C11H23N3O3 — CID 81081646
2-amino-3-methoxy-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 81081646) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | 2-amino-3-methoxy-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 81081646 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 2-amino-3-methoxy-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | COCC(N)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C11H23N3O3/c1-16-9-10(12)11(15)13-3-2-4-14-5-7-17-8-6-14/h10H,2-9,12H2,1H3,(H,13,15) |
| InChIKey | JDTVWIFWGUTMSU-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|