C13H27N5O3 — CID 111037016
2-[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111037016) has the molecular formula C13H27N5O3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111037016 |
| Molecular Formula | C13H27N5O3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | 2-[[amino-(3-morpholin-4-ylpropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C/N=C(\N)NCCCN1CCOCC1 |
| InChI | InChI=1S/C13H27N5O3/c1-20-8-4-15-12(19)11-17-13(14)16-3-2-5-18-6-9-21-10-7-18/h2-11H2,1H3,(H,15,19)(H3,14,16,17) |
| InChIKey | BQANIEXTAWFIEV-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|