C17H32N6O2 — CID 111083643
2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111083643) has the molecular formula C17H32N6O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111083643 |
| Molecular Formula | C17H32N6O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | COCCn1nc(C)c(C/N=C(\N)NCCCN2CCOCC2)c1C |
| InChI | InChI=1S/C17H32N6O2/c1-14-16(15(2)23(21-14)9-10-24-3)13-20-17(18)19-5-4-6-22-7-11-25-12-8-22/h4-13H2,1-3H3,(H3,18,19,20) |
| InChIKey | QFOOWJSVYIUPQL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|