C18H35N5O — CID 111083625
2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-octylguanidine (PubChem CID 111083625) has the molecular formula C18H35N5O and a molecular weight of 337.51 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-octylguanidine.
| Compound Name | 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-octylguanidine |
|---|---|
| PubChem CID | 111083625 |
| Molecular Formula | C18H35N5O |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-octylguanidine |
| SMILES | CCCCCCCCN/C(N)=N/Cc1c(C)nn(CCOC)c1C |
| InChI | InChI=1S/C18H35N5O/c1-5-6-7-8-9-10-11-20-18(19)21-14-17-15(2)22-23(16(17)3)12-13-24-4/h5-14H2,1-4H3,(H3,19,20,21) |
| InChIKey | MKSNJFCVOLDEQN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|