C19H30IN5O2 — CID 111083672
2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111083672) has the molecular formula C19H30IN5O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111083672 |
| Molecular Formula | C19H30IN5O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | COCCn1nc(C)c(C/N=C(\N)Nc2ccc(OC(C)C)cc2)c1C.I |
| InChI | InChI=1S/C19H29N5O2.HI/c1-13(2)26-17-8-6-16(7-9-17)22-19(20)21-12-18-14(3)23-24(15(18)4)10-11-25-5;/h6-9,13H,10-12H2,1-5H3,(H3,20,21,22);1H |
| InChIKey | ZGBVBYKERWFCJU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|