C20H23N5 — CID 110914092
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-phenylguanidine (PubChem CID 110914092) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-phenylguanidine.
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 110914092 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-phenylguanidine |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C/N=C(\N)Nc1ccccc1 |
| InChI | InChI=1S/C20H23N5/c1-15-19(13-22-20(21)23-18-11-7-4-8-12-18)16(2)25(24-15)14-17-9-5-3-6-10-17/h3-12H,13-14H2,1-2H3,(H3,21,22,23) |
| InChIKey | NONDUYFDQSOUBM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|