C21H24ClN5O — CID 111036472
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine (PubChem CID 111036472) has the molecular formula C21H24ClN5O and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine.
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111036472 |
| Molecular Formula | C21H24ClN5O |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2c(C)nn(Cc3ccccc3)c2C)cc1Cl |
| InChI | InChI=1S/C21H24ClN5O/c1-14-18(15(2)27(26-14)13-16-7-5-4-6-8-16)12-24-21(23)25-17-9-10-20(28-3)19(22)11-17/h4-11H,12-13H2,1-3H3,(H3,23,24,25) |
| InChIKey | LSVTXHVZZQDVOG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|