C21H22ClIN4O2 — CID 111050585
1-(3-chloro-4-methoxyphenyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111050585) has the molecular formula C21H22ClIN4O2 and a molecular weight of 524.79 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111050585 |
| Molecular Formula | C21H22ClIN4O2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2cccnc2OCc2ccccc2)cc1Cl.I |
| InChI | InChI=1S/C21H21ClN4O2.HI/c1-27-19-10-9-17(12-18(19)22)26-21(23)25-13-16-8-5-11-24-20(16)28-14-15-6-3-2-4-7-15;/h2-12H,13-14H2,1H3,(H3,23,25,26);1H |
| InChIKey | DMZRATUQVAFFED-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|