C22H27N5 — CID 111036450
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-ethylphenyl)guanidine (PubChem CID 111036450) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-ethylphenyl)guanidine.
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 111036450 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(3-ethylphenyl)guanidine |
| SMILES | CCc1cccc(N/C(N)=N/Cc2c(C)nn(Cc3ccccc3)c2C)c1 |
| InChI | InChI=1S/C22H27N5/c1-4-18-11-8-12-20(13-18)25-22(23)24-14-21-16(2)26-27(17(21)3)15-19-9-6-5-7-10-19/h5-13H,4,14-15H2,1-3H3,(H3,23,24,25) |
| InChIKey | GKWXVYXDMWMRBQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|