C17H26IN5 — CID 111036425
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-propylguanidine;hydroiodide (PubChem CID 111036425) has the molecular formula C17H26IN5 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111036425 |
| Molecular Formula | C17H26IN5 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/Cc1c(C)nn(Cc2ccccc2)c1C.I |
| InChI | InChI=1S/C17H25N5.HI/c1-4-10-19-17(18)20-11-16-13(2)21-22(14(16)3)12-15-8-6-5-7-9-15;/h5-9H,4,10-12H2,1-3H3,(H3,18,19,20);1H |
| InChIKey | MNVJVBMCYUTKNB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|