C20H21ClN4O — CID 27870285
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(4-chlorophenyl)urea (PubChem CID 27870285) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 27870285 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(4-chlorophenyl)urea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN4O/c1-14-19(12-22-20(26)23-18-10-8-17(21)9-11-18)15(2)25(24-14)13-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3,(H2,22,23,26) |
| InChIKey | ORYMZMOIEOMUHR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |