C20H21N5O3 — CID 27870291
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(3-nitrophenyl)urea (PubChem CID 27870291) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 27870291 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-(3-nitrophenyl)urea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N5O3/c1-14-19(15(2)24(23-14)13-16-7-4-3-5-8-16)12-21-20(26)22-17-9-6-10-18(11-17)25(27)28/h3-11H,12-13H2,1-2H3,(H2,21,22,26) |
| InChIKey | ADZZXWCQZCEJTE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|