C19H17ClFN5O3 — CID 2212241
1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-nitrophenyl)urea (PubChem CID 2212241) has the molecular formula C19H17ClFN5O3 and a molecular weight of 417.83 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 2212241 |
| Molecular Formula | C19H17ClFN5O3 |
| Molecular Weight | 417.83 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(3-nitrophenyl)urea |
| SMILES | Cc1nn(Cc2c(F)cccc2Cl)c(C)c1NC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17ClFN5O3/c1-11-18(23-19(27)22-13-5-3-6-14(9-13)26(28)29)12(2)25(24-11)10-15-16(20)7-4-8-17(15)21/h3-9H,10H2,1-2H3,(H2,22,23,27) |
| InChIKey | BZKWCHSZSZIEAV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|