C16H12ClF8N3O — CID 19393775
N-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19393775) has the molecular formula C16H12ClF8N3O and a molecular weight of 449.73 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19393775 |
| Molecular Formula | C16H12ClF8N3O |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | Cc1nn(Cc2c(F)cccc2Cl)c(C)c1NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H12ClF8N3O/c1-7-12(26-13(29)14(19,20)15(21,22)16(23,24)25)8(2)28(27-7)6-9-10(17)4-3-5-11(9)18/h3-5H,6H2,1-2H3,(H,26,29) |
| InChIKey | YPQCYRWDETUMFJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|