C21H22ClFN4S — CID 19342997
1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-ethylphenyl)thiourea (PubChem CID 19342997) has the molecular formula C21H22ClFN4S and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 19342997 |
| Molecular Formula | C21H22ClFN4S |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)Nc2c(C)nn(Cc3c(F)cccc3Cl)c2C)cc1 |
| InChI | InChI=1S/C21H22ClFN4S/c1-4-15-8-10-16(11-9-15)24-21(28)25-20-13(2)26-27(14(20)3)12-17-18(22)6-5-7-19(17)23/h5-11H,4,12H2,1-3H3,(H2,24,25,28) |
| InChIKey | GCSIYUMLWDAHMX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|