C18H20ClFN6S — CID 19326731
1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-methylpyrazol-4-yl)methyl]thiourea (PubChem CID 19326731) has the molecular formula C18H20ClFN6S and a molecular weight of 406.92 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-methylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-methylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19326731 |
| Molecular Formula | C18H20ClFN6S |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1-methylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1nn(Cc2c(F)cccc2Cl)c(C)c1NC(=S)NCc1cnn(C)c1 |
| InChI | InChI=1S/C18H20ClFN6S/c1-11-17(23-18(27)21-7-13-8-22-25(3)9-13)12(2)26(24-11)10-14-15(19)5-4-6-16(14)20/h4-6,8-9H,7,10H2,1-3H3,(H2,21,23,27) |
| InChIKey | LIEHPZIVPIJGQH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|