C25H26N6O5 — CID 55463967
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55463967) has the molecular formula C25H26N6O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55463967 |
| Molecular Formula | C25H26N6O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)CN1C(=O)NC(C)(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C25H26N6O5/c1-16-21(17(2)30(28-16)14-18-7-5-4-6-8-18)13-26-22(32)15-29-23(33)25(3,27-24(29)34)19-9-11-20(12-10-19)31(35)36/h4-12H,13-15H2,1-3H3,(H,26,32)(H,27,34) |
| InChIKey | FIUHJDOPCQBXHL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|