C17H18N6O2 — CID 133467618
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine (PubChem CID 133467618) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine.
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 133467618 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNc1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H18N6O2/c1-12-16(10-20-17-18-8-15(9-19-17)23(24)25)13(2)22(21-12)11-14-6-4-3-5-7-14/h3-9H,10-11H2,1-2H3,(H,18,19,20) |
| InChIKey | OECVLIZKZKZSRI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|