C17H27BrN4O3 — CID 111098935
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111098935) has the molecular formula C17H27BrN4O3 and a molecular weight of 415.33 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111098935 |
| Molecular Formula | C17H27BrN4O3 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | COc1cc(Br)c(C/N=C(\N)NCCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C17H27BrN4O3/c1-23-15-10-13(14(18)11-16(15)24-2)12-21-17(19)20-4-3-5-22-6-8-25-9-7-22/h10-11H,3-9,12H2,1-2H3,(H3,19,20,21) |
| InChIKey | XLNIAVQLENNFIB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|