C18H30BrIN4O2 — CID 110032189
2-[3-(4-bromo-2-methoxyphenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110032189) has the molecular formula C18H30BrIN4O2 and a molecular weight of 541.27 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-methoxyphenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(4-bromo-2-methoxyphenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110032189 |
| Molecular Formula | C18H30BrIN4O2 |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 2-[3-(4-bromo-2-methoxyphenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | COc1cc(Br)ccc1CCC/N=C(\N)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C18H29BrN4O2.HI/c1-24-17-14-16(19)6-5-15(17)4-2-7-21-18(20)22-8-3-9-23-10-12-25-13-11-23;/h5-6,14H,2-4,7-13H2,1H3,(H3,20,21,22);1H |
| InChIKey | XZNBLVZQRKZRSL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|