C17H28BrIN4O — CID 111807979
2-[3-(3-bromophenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111807979) has the molecular formula C17H28BrIN4O and a molecular weight of 511.25 g/mol. Its IUPAC name is 2-[3-(3-bromophenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(3-bromophenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807979 |
| Molecular Formula | C17H28BrIN4O |
| Molecular Weight | 511.25 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-[3-(3-bromophenyl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCc1cccc(Br)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H27BrN4O.HI/c18-16-6-1-4-15(14-16)5-2-7-20-17(19)21-8-3-9-22-10-12-23-13-11-22;/h1,4,6,14H,2-3,5,7-13H2,(H3,19,20,21);1H |
| InChIKey | NTRHMMUATHTZMD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|