C20H28N4O — CID 111069794
2-(3-morpholin-4-ylpropyl)-1-(2-naphthalen-2-ylethyl)guanidine (PubChem CID 111069794) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropyl)-1-(2-naphthalen-2-ylethyl)guanidine.
| Compound Name | 2-(3-morpholin-4-ylpropyl)-1-(2-naphthalen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111069794 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 2-(3-morpholin-4-ylpropyl)-1-(2-naphthalen-2-ylethyl)guanidine |
| SMILES | N/C(=N\CCCN1CCOCC1)NCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H28N4O/c21-20(22-9-3-11-24-12-14-25-15-13-24)23-10-8-17-6-7-18-4-1-2-5-19(18)16-17/h1-2,4-7,16H,3,8-15H2,(H3,21,22,23) |
| InChIKey | NDWJBEKOWOPVDK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|